| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | tert-Butyl 8-amino-5-thia-2-azaspiro[3.4]octane-2-carboxylate 5,5-dioxide Basic information |
| Product Name: | tert-Butyl 8-amino-5-thia-2-azaspiro[3.4]octane-2-carboxylate 5,5-dioxide | | Synonyms: | tert-Butyl 8-amino-5-thia-2-azaspiro[3.4]octane-2-carboxylate 5,5-dioxide;2-Boc-8-amino-5-thia-2-azaspiro[3.4]octane 5,5-dioxide 95%;2-Boc-8-amino-5-thia-2-azaspiro[3.4]octane 5,5-dioxide;Tert-Butyl 8-Amino-5-Thia-2-Azaspiro[3.4]Octane-2-Carboxylate 5,5-Dioxide(WX100812);5-Thia-2-azaspiro[3.4]octane-2-carboxylic acid, 8-amino-, 1,1-dimethylethyl ester, 5,5-dioxide;tert-Butyl 8-amino-5-thia-2-azaspiro[3.4]octane-2-carboxylate 5,5-dioxide hydrochloride;2-Boc-8-amino-5-thia-2-azaspiro[3.4]octane 5,5-dioxide | | CAS: | 1340481-83-5 | | MF: | C11H20N2O4S | | MW: | 276.35 | | EINECS: | | | Product Categories: | | | Mol File: | 1340481-83-5.mol | ![tert-Butyl 8-amino-5-thia-2-azaspiro[3.4]octane-2-carboxylate 5,5-dioxide Structure](CAS/GIF/1340481-83-5.gif) |
| | tert-Butyl 8-amino-5-thia-2-azaspiro[3.4]octane-2-carboxylate 5,5-dioxide Chemical Properties |
| storage temp. | 2-8°C | | form | liquid | | InChI | 1S/C11H20N2O4S/c1-10(2,3)17-9(14)13-6-11(7-13)8(12)4-5-18(11,15)16/h8H,4-7,12H2,1-3H3 | | InChIKey | WMBSIHWRPQTLQI-UHFFFAOYSA-N | | SMILES | NC1CCS(C21CN(C(OC(C)(C)C)=O)C2)(=O)=O |
| WGK Germany | WGK 3 | | HS Code | 2922390090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | tert-Butyl 8-amino-5-thia-2-azaspiro[3.4]octane-2-carboxylate 5,5-dioxide Usage And Synthesis |
| Uses | Spirocyclic building block was first synthesized by Carreira and coworkers, which provides a new area of chemical space with straightforward functional handles for further diversification. |
| | tert-Butyl 8-amino-5-thia-2-azaspiro[3.4]octane-2-carboxylate 5,5-dioxide Preparation Products And Raw materials |
|