| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
3,3-Difluoro-cyclopentaneMethanol manufacturers
|
| | 3,3-Difluoro-cyclopentaneMethanol Basic information | | Uses |
| Product Name: | 3,3-Difluoro-cyclopentaneMethanol | | Synonyms: | 3,3-Difluoro-cyclopentaneMethanol;3,3-Difluoro-cyclopentanemethanol - D11725;Cyclopentanemethanol, 3,3-difluoro-;3,3-Difluoro-1-(hydroxymethyl)cyclopentane;(3,3-difluorocyclopentyl)methanol | | CAS: | 883731-63-3 | | MF: | C6H10F2O | | MW: | 136.14 | | EINECS: | | | Product Categories: | | | Mol File: | 883731-63-3.mol |  |
| | 3,3-Difluoro-cyclopentaneMethanol Chemical Properties |
| density | 1.15g/ml | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H10F2O/c7-6(8)2-1-5(3-6)4-9/h5,9H,1-4H2 | | InChIKey | QLMRIAAVEVHRJH-UHFFFAOYSA-N | | SMILES | C1(CO)CCC(F)(F)C1 |
| | 3,3-Difluoro-cyclopentaneMethanol Usage And Synthesis |
| Uses | (3,3-difluorocyclopentyl)methanol is a useful research chemical. |
| | 3,3-Difluoro-cyclopentaneMethanol Preparation Products And Raw materials |
|