|
|
| | N-(4-BroMo-phenyl)-benzene-1,2-diaMine Basic information |
| Product Name: | N-(4-BroMo-phenyl)-benzene-1,2-diaMine | | Synonyms: | N-(4-Bromophenyl)-1,2-benzenediamine;N-(4-BroMo-phenyl)-benzene-1,2-diaMine;N1-(4-bromophenyl)-1,2-benzenediamine;N1-(4-bromophenyl)benzene-1,2-diamine;1,2-Benzenediamine, N1-(4-bromophenyl)-;N-(4-Bromophenyl)-o-phenylenediamine | | CAS: | 100953-52-4 | | MF: | C12H11BrN2 | | MW: | 263.13 | | EINECS: | | | Product Categories: | | | Mol File: | 100953-52-4.mol |  |
| | N-(4-BroMo-phenyl)-benzene-1,2-diaMine Chemical Properties |
| Melting point | 128 °C | | Boiling point | 373.3±27.0 °C(Predicted) | | density | 1.512±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 4.90±0.10(Predicted) | | Appearance | Off-white to gray Solid | | InChI | InChI=1S/C12H11BrN2/c13-9-5-7-10(8-6-9)15-12-4-2-1-3-11(12)14/h1-8,15H,14H2 | | InChIKey | LCLAHXCIHJAZIF-UHFFFAOYSA-N | | SMILES | C1(NC2=CC=C(Br)C=C2)=CC=CC=C1N |
| | N-(4-BroMo-phenyl)-benzene-1,2-diaMine Usage And Synthesis |
| | N-(4-BroMo-phenyl)-benzene-1,2-diaMine Preparation Products And Raw materials |
|