| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | (1S,2S)-1,2-Bis(2-hydroxyphenyl)ethylenediaMine Basic information |
| Product Name: | (1S,2S)-1,2-Bis(2-hydroxyphenyl)ethylenediaMine | | Synonyms: | 2,2-[(1S,2S)-1,2-Diamino-1,2-ethanediyl]bisphenol;(1S,2S)-1,2-Bis(2-hydroxyphenyl)ethylenediamine;Phenol, 2,?2'-?[(1S,?2S)?-?1,?2-?diamino-?1,?2-?ethanediyl]?bis-;(1S,2S)-1,2-Bis(2-hydroxyphenyl)ethylenediamine >(1S,2S)-1,2-Diamino-1,2-bis(2-hydroxyphenyl)ethane;2,2'-[(1S,2S)-1,2-Diaminoethylene]bisphenol;2,2'-((1S,2S)-1,2-Diaminoethane-1,2-diyl)diphenol;(1S,2S)-1,2-bis(2-hydroxyphenyl)ethyldiamine | | CAS: | 870991-68-7 | | MF: | C14H16N2O2 | | MW: | 244.29 | | EINECS: | | | Product Categories: | | | Mol File: | 870991-68-7.mol |  |
| | (1S,2S)-1,2-Bis(2-hydroxyphenyl)ethylenediaMine Chemical Properties |
| Melting point | 159 °C(dec.) | | solubility | slightly sol. in Chloroform | | form | powder to crystal | | color | White to Light yellow to Light orange | | Optical Rotation | [α]22/D -65°, c =0.2 in chloroform | | InChI | 1S/C14H16N2O2/c15-13(9-5-1-3-7-11(9)17)14(16)10-6-2-4-8-12(10)18/h1-8,13-14,17-18H,15-16H2/t13-,14-/m0/s1 | | InChIKey | MRNPLGLZBUDMRE-KBPBESRZSA-N | | SMILES | N[C@H]([C@@H](N)c1ccccc1O)c2ccccc2O |
| WGK Germany | WGK 3 | | HS Code | 2922.19.7000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | (1S,2S)-1,2-Bis(2-hydroxyphenyl)ethylenediaMine Usage And Synthesis |
| Uses | 2,2''-[(1S,2S)-1,2-Diamino-1,2-ethanediyl]bisphenol is a useful synthetic compound. |
| | (1S,2S)-1,2-Bis(2-hydroxyphenyl)ethylenediaMine Preparation Products And Raw materials |
|