| Company Name: |
Shanghai Jinsheng Pharmaceutical Co., Ltd. Gold
|
| Tel: |
1365-13651960330 13651960330 |
| Email: |
xiangfeixia@jspharmatech.com |
| Products Intro: |
Product Name:5-bromo-3-(ethyl(tetrahydro-2H-pyran-4-yl)amino)-2-methylbenzoic acid
CAS:1403257-81-7
Purity:98%
|
| Company Name: |
Haoyuan Chemexpress Co., Ltd.
|
| Tel: |
021-58950125 |
| Email: |
info@chemexpress.com |
| Products Intro: |
Product Name:Benzoic acid, 5-bromo-3-[ethyl(tetrahydro-2H-pyran-4-yl)amino]-2-methyl-
CAS:1403257-81-7
Purity:>98% Package:7905RMB/1g
|
|
| | Benzoic acid, 5-broMo-3-[ethyl(tetrahydro-2H-pyran-4-yl)aMino]-2-Methyl- Basic information | | Application |
| | Benzoic acid, 5-broMo-3-[ethyl(tetrahydro-2H-pyran-4-yl)aMino]-2-Methyl- Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C15H20BrNO3/c1-3-17(12-4-6-20-7-5-12)14-9-11(16)8-13(10(14)2)15(18)19/h8-9,12H,3-7H2,1-2H3,(H,18,19) | | InChIKey | IPITXYVHPYUULP-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(Br)=CC(N(CC)C2CCOCC2)=C1C |
| | Benzoic acid, 5-broMo-3-[ethyl(tetrahydro-2H-pyran-4-yl)aMino]-2-Methyl- Usage And Synthesis |
| Application | 5-Bromo-3-(ethyl(tetrahydro-2H-pyran-4-yl)amino)-2-methylbenzoic acid can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly in laboratory research and development processes and chemical production processes. |
| | Benzoic acid, 5-broMo-3-[ethyl(tetrahydro-2H-pyran-4-yl)aMino]-2-Methyl- Preparation Products And Raw materials |
|