- 4-Hydrazinobenzoic acid
-
- $0.00 / 1KG
-
2026-04-17
- CAS:619-67-0
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | 4-Hydrazinylbenzoic acid Basic information |
| | 4-Hydrazinylbenzoic acid Chemical Properties |
| Melting point | 218 °C (dec.) (lit.) | | Boiling point | 274.61°C (rough estimate) | | density | 1.2804 (rough estimate) | | refractive index | 1.5200 (estimate) | | Fp | >110° | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | pka | 4.14±0.10(Predicted) | | form | Crystalline Powder | | color | Light yellow to light brown | | BRN | 387378 | | Stability: | Stable. Combustible. Incompatible with strong acids, strong oxidizing agents. | | InChI | InChI=1S/C7H8N2O2/c8-9-6-3-1-5(2-4-6)7(10)11/h1-4,9H,8H2,(H,10,11) | | InChIKey | PCNFLKVWBDNNOW-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(NN)C=C1 | | CAS DataBase Reference | 619-67-0(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 4-hydrazino- (619-67-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 1 | | RTECS | DH1700000 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29280000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Hydrazinylbenzoic acid Usage And Synthesis |
| Chemical Properties | solid | | Uses | 4-Hydrazinobenzoic acid was used in the synthesis of multi-substituted dihydropyrano[2,3-c]pyrazole derivatives. | | Purification Methods | The hydrochloride [24589-37-3] M 188.6, has m 253o(dec) [Beilstein 15 III 837]. |
| | 4-Hydrazinylbenzoic acid Preparation Products And Raw materials |
|