| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
- TCS 401
-
- $40.00
-
2026-07-27
- CAS:243966-09-8
- Purity: 98.15%
- Supply Ability: 10g
|
| | TCS 401 Basic information |
| Product Name: | TCS 401 | | Synonyms: | TCS-401;TCS401;TCS 401 HCl;TCS-401 Hydrochloride;TCS-401,inhibit,TCS 401,Inhibitor,TCS401,Phosphatase;2-(Carboxyformamido)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid hydrochloride;TCS 401, 10 mM in DMSO;2-(Oxaloamino)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid hydrochloride | | CAS: | 243966-09-8 | | MF: | C10H11ClN2O5S | | MW: | 306.72 | | EINECS: | | | Product Categories: | | | Mol File: | 243966-09-8.mol |  |
| | TCS 401 Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | 0.1 M NaOH: 5 mg/ml | | form | A crystalline solid | | color | Light yellow to khaki | | InChIKey | LQGCAMWQDSYOAY-UHFFFAOYSA-N | | SMILES | [s]1c2c(c(c1NC(=O)C(=O)O)C(=O)O)CC[N+H2]C2.[Cl-] |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | TCS 401 Usage And Synthesis |
| Uses | TCS 401 binds the functional spine PTP1B and inhibits its function in PTP1B related diseases like cancer, obesity and diabetes. | | Biological Activity | TCS 401 is a selective inhibitor of protein-tyrosine phosphatase 1B (PTP1B), which plays a key role in the negative regulation of the insulin signaling pathway, contributing to insulin resistance. It exhibited Ki values of 290 nM for PTP1B, with greater than 100-fold or more selectivity compared to other phosphatases. Inhibition of PTP1B by TCS 401 has been shown to sensitize the insulin signaling pathway and increase dopamine release in response to insulin. TCS-401 has also been shown to promote endothelial cell motility and to induce differentiation of retinal pigment epithelial cells toward improved contractility and motility. | | storage | Desiccate at RT |
| | TCS 401 Preparation Products And Raw materials |
|