|
|
| | 2,4-Bis([1,1'-biphenyl]-4-yl)-6-chloro-1,3,5-triazine Basic information |
| Product Name: | 2,4-Bis([1,1'-biphenyl]-4-yl)-6-chloro-1,3,5-triazine | | Synonyms: | 2-chloro-4,6-di(biphenyl-4-yl)-1,3,5-triazine;1,3,5-Triazine, 2,4-bis([1,1'-biphenyl]-4-yl)-6-chloro-;2,4-Bis(4-biphenylyl)-6-chloro-1,3,5-triazine;2,4-Di([1,1'-biphenyl]-4-yl)-6-chloro-1,3,5-triazine;2-chloro-4,6-bis(4-biphenylyl)-1,3,5-triazine;2,4-Bis-biphenyl-4-yl-6-chloro-[1,3,5]triazine;2,4-Bis([1,1'-biphenyl]-4-yl)-6-chloro-1,3,5-triazine;2,4-di(biphenyl-4-yl)-6-chloro-1,3,5-triazine | | CAS: | 182918-13-4 | | MF: | C27H18ClN3 | | MW: | 419.9 | | EINECS: | | | Product Categories: | 1,3,5-triazine;OLED | | Mol File: | 182918-13-4.mol | ![2,4-Bis([1,1'-biphenyl]-4-yl)-6-chloro-1,3,5-triazine Structure](CAS/20150408/GIF/182918-13-4.gif) |
| | 2,4-Bis([1,1'-biphenyl]-4-yl)-6-chloro-1,3,5-triazine Chemical Properties |
| Melting point | 215.0 to 219.0 °C | | Boiling point | 649.6±58.0 °C(Predicted) | | density | 1.227±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | pka | 0.28±0.10(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C27H18ClN3/c28-27-30-25(23-15-11-21(12-16-23)19-7-3-1-4-8-19)29-26(31-27)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18H | | InChIKey | FVQBRDRAILXTMJ-UHFFFAOYSA-N | | SMILES | N1=C(Cl)N=C(C2=CC=C(C3=CC=CC=C3)C=C2)N=C1C1=CC=C(C2=CC=CC=C2)C=C1 |
| | 2,4-Bis([1,1'-biphenyl]-4-yl)-6-chloro-1,3,5-triazine Usage And Synthesis |
| Chemical Properties | White to Orange to Green powder to crystal. | | Uses | 2,4-Bis([1,1'-biphenyl]-4-yl)-6-chloro-1,3,5-triazine is used in photoelectric materials; semiconductor building blocks; synthetic material intermediates, etc. |
| | 2,4-Bis([1,1'-biphenyl]-4-yl)-6-chloro-1,3,5-triazine Preparation Products And Raw materials |
|