|
|
| | 5-hydroxy-3-Methyl-2(5H)-furanone Basic information |
| Product Name: | 5-hydroxy-3-Methyl-2(5H)-furanone | | Synonyms: | 2(5H)-Furanone, 5-hydroxy-3-methyl-;2-hydroxy-4-methyl-2H-furan-5-one;5-hydroxy-3-Methyl-2(5H)-furanone;5-Hydroxy-3-methylfuran-2(5H)-one;5-Hydroxy-3-methyl-2,5-dihydrofuran-2-one;5-HYDROXY-3-METHYLFURAN-2(5H)-ONE (HO-D) | | CAS: | 931-23-7 | | MF: | C5H6O3 | | MW: | 114.1 | | EINECS: | | | Product Categories: | | | Mol File: | 931-23-7.mol |  |
| | 5-hydroxy-3-Methyl-2(5H)-furanone Chemical Properties |
| Melting point | 72-73 °C | | Boiling point | 90 °C(Press: 0.1 Torr) | | density | 1.349±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly) | | pka | 10.03±0.40(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C5H6O3/c1-3-2-4(6)8-5(3)7/h2,4,6H,1H3 | | InChIKey | HQIZYPQNJWENRT-UHFFFAOYSA-N | | SMILES | O1C(O)C=C(C)C1=O |
| | 5-hydroxy-3-Methyl-2(5H)-furanone Usage And Synthesis |
| Uses | Hydroxybutenolide can be used as reactant/reagent for synthetic preparation for enantioselective preparation of hydroxy-GR24 stereoisomers via contra-biomimetic nucleophilic cyclization. |
| | 5-hydroxy-3-Methyl-2(5H)-furanone Preparation Products And Raw materials |
| Raw materials | Butanoic acid, 2,4,4-trichloro-2-methyl-, methyl ester-->3-(4-Methyl-5-oxo-2,5-dihydro-furan-2-yloxymethylene)-3,3a,4,8b-tetrahydro-indeno[1,2-b]furan-2-one , GR-24, Germination Stimulant, strigolactone GR 24-->Furan, 3-methyl-2-[[tris(1-methylethyl)silyl]oxy]--->ethyl 4-acetoxy-4-chloro-2-hydroxy-2-methylbutanoate-->3-Methyl-2-furoic acid-->5-HYDROXY-4-METHYL-2(5H)FURANONE-->2(5H)-Furanone-->1,2-Ethenediylbis(oxy) (9CI)-->2-Methylpropanedioic acid-->Vinyl acetate-->Ethyl pyruvate-->Citraconic anhydride |
|