|
|
| | diMethyl 4,6-dihydroxyisophthalate Basic information |
| Product Name: | diMethyl 4,6-dihydroxyisophthalate | | Synonyms: | diMethyl 4,6-dihydroxyisophthalate;Dimethyl 2,4-Dihydroxybenzene-1,5-Dicarboxylate;4,6-Dihydroxy-1,3-benzenedicarboxylic acid dimethyl ester;4,6-dihydroxy-, 1,3-dimethyl ester;N-HydN-Hydroxy-2-pyridinecarboxamide;1,3-Benzenedicarboxylic acid, 4,6-dihydroxy-, 1,3-dimethyl ester;4,6-Dihydroxyisophthalic acid dimethyl ester | | CAS: | 52959-28-1 | | MF: | C10H10O6 | | MW: | 226.18 | | EINECS: | | | Product Categories: | | | Mol File: | 52959-28-1.mol |  |
| | diMethyl 4,6-dihydroxyisophthalate Chemical Properties |
| Boiling point | 429.8±25.0 °C(Predicted) | | density | 1.395±0.06 g/cm3(Predicted) | | storage temp. | RT, stored under nitrogen | | pka | 7.65±0.23(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H10O6/c1-15-9(13)5-3-6(10(14)16-2)8(12)4-7(5)11/h3-4,11-12H,1-2H3 | | InChIKey | CMTOZSKJCALTLF-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=C(O)C=C(O)C(C(OC)=O)=C1 |
| | diMethyl 4,6-dihydroxyisophthalate Usage And Synthesis |
| | diMethyl 4,6-dihydroxyisophthalate Preparation Products And Raw materials |
|