| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:ML169 >=98% (HPLC) CAS:1222878-02-5 Purity:NULL Package:25mg;5mg Remarks:NULL
|
| Company Name: |
TargetMol Chemicals Inc.
|
| Tel: |
15002134094 |
| Email: |
marketing@targetmol.cn |
| Products Intro: |
Product Name:ML169 CAS:1222878-02-5 Package:50mg/RMB 13800;100mg/RMB 17500;25mg/RMB 10600
|
VU0405652 manufacturers
- ML169
-
- $1980.00
-
2026-05-11
- CAS:1222878-02-5
- Purity:
- Supply Ability: 10g
|
| | VU0405652 Basic information |
| Product Name: | VU0405652 | | Synonyms: | 2-[[1-[(5-Bromo-2-fluorophenyl)methyl]-1H-indol-3-yl]sulfonyl]-N-(5-methyl-3-isoxazolyl)-acetamide;ML169;VU0405652;ML169 >=98% (HPLC);Acetamide, 2-[[1-[(5-bromo-2-fluorophenyl)methyl]-1H-indol-3-yl]sulfonyl]-N-(5-methyl-3-isoxazolyl)- | | CAS: | 1222878-02-5 | | MF: | C21H17BrFN3O4S | | MW: | 506.34 | | EINECS: | | | Product Categories: | | | Mol File: | 1222878-02-5.mol |  |
| | VU0405652 Chemical Properties |
| Boiling point | 784.2±60.0 °C(Predicted) | | density | 1.60±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: >5mg/mL | | form | powder | | pka | 10.57±0.70(Predicted) | | color | white to beige | | InChI | 1S/C21H17BrFN3O4S/c1-13-8-20(25-30-13)24-21(27)12-31(28,29)19-11-26(18-5-3-2-4-16(18)19)10-14-9-15(22)6-7-17(14)23/h2-9,11H,10,12H2,1H3,(H,24,25,27) | | InChIKey | RUYRNYRGPSAXTK-UHFFFAOYSA-N | | SMILES | Cc1cc(NC(=O)CS(=O)(=O)c2cn(Cc3cc(Br)ccc3F)c4ccccc24)no1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | VU0405652 Usage And Synthesis |
| Uses | ML169 (VU0405652) is a potent, selective and brain penetrant positive allosteric modulator (PAM) of M1 mAChR, with an EC50 of 1.38 μM. ML169 is a MLPCN probe and can be used for Alzheimer’s disease[1]. | | Biological Activity | ML169 is a positive allosteric modulator (PAM) of the muscarinic acetylcholine receptor M1 (CHRM1). ML169 does not cross react with other muscarinic receptors and is able to penetrate the blood brain barrier. | | in vivo | ML169 (VU0405652) (10 mg/kg; i.p.) affords a brainAUC/plasmaAUC of 0.32 at 1 h in rats[1]. | | References | [1] Reid PR, et al. Discovery and optimization of a novel, selective and brain penetrant M1 positive allosteric modulator (PAM): the development of ML169, an MLPCN probe. Bioorg Med Chem Lett. 2011 May 1;21(9):2697-701. DOI:10.1016/j.bmcl.2010.12.015 |
| | VU0405652 Preparation Products And Raw materials |
|