| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Methyl 2-[methyl(4-pyridinyl)carbamothioylthio]propionate
CAS:1158958-92-9
Purity:97% Package:5G Remarks:735639-5G
|
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Products Intro: |
Product Name:Methyl 2-[methyl(4-pyridinyl)carbamothioylthio]propionate
CAS:1158958-92-9
Purity:97% Package:1g;10g;100g;1KG;5KG
|
| Company Name: |
MQ (shanghai) Pharmaceuticals Co., Ltd.
|
| Tel: |
13761635123 |
| Email: |
sales@linyuepharm.com |
| Products Intro: |
Product Name:Methyl 2-((methyl(pyridin-4-yl)carbamothioyl)thio)propanoate
CAS:1158958-92-9
Purity:＞95% Package:1G，5G
|
|
| | Methyl 2-[methyl(4-pyridinyl)carbamothioylthio]propionate Basic information |
| Product Name: | Methyl 2-[methyl(4-pyridinyl)carbamothioylthio]propionate | | Synonyms: | Methyl 2-[methyl(4-pyridinyl)carbamothioylthio]propionate 97%;Methyl 2-[methyl(4-pyridinyl)carbamothioylthio]propionate;Propanoic acid, 2-[[(methyl-4-pyridinylamino)thioxomethyl]thio]-, methyl ester;Methyl 2-((methyl(pyridin-4-yl)carbamothioyl)thio)propanoate | | CAS: | 1158958-92-9 | | MF: | C11H14N2O2S2 | | MW: | 270.37 | | EINECS: | | | Product Categories: | | | Mol File: | 1158958-92-9.mol | ![Methyl 2-[methyl(4-pyridinyl)carbamothioylthio]propionate Structure](CAS/20180703/GIF/1158958-92-9.gif) |
| | Methyl 2-[methyl(4-pyridinyl)carbamothioylthio]propionate Chemical Properties |
| Melting point | 76-81°C | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C11H14N2O2S2/c1-8(10(14)15-3)17-11(16)13(2)9-4-6-12-7-5-9/h4-8H,1-3H3 | | InChIKey | LOGGAKBRSDSFSB-UHFFFAOYSA-N | | SMILES | COC(=O)C(C)SC(=S)N(C)c1ccncc1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | Methyl 2-[methyl(4-pyridinyl)carbamothioylthio]propionate Usage And Synthesis |
| Uses | Switchable RAFT agent for controlled radical polymerization. The neutral form is well-suited for polymerization of vinyl esters and vinyl amides (LAMs), and the protonated form is well-suited for styrenes acrylates and methacrylates (MAMs). Chain Transfer Agent (CTA) |
| | Methyl 2-[methyl(4-pyridinyl)carbamothioylthio]propionate Preparation Products And Raw materials |
|