| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Di-tert-butyl(2-dimethylaminophenyl)phosphine Basic information | | Reaction |
| Product Name: | Di-tert-butyl(2-dimethylaminophenyl)phosphine | | Synonyms: | 2-(Di-tert-butylphosphino)dimethylaminobenzene;2-(Di-tert-butylphosphino)-N,N-dimethylaniline;Di-tert-butyl(2-dimethylaminophenyl)phosphine;[2-(N,N-DIMETHYLAMINO)PHENYL]DI-T-BUTYLPHOSPHINE,MIN.95%;[2-(N,N-Dimethylamino)phenyl]di-t-butylphosphine, min. 95%;phosphino)dimethyL;Benzenamine, 2-[bis(1,1-dimethylethyl)phosphino]-N,N-dimethyl-;o-(di(tert-butyl)phosphino)-N,N-dimethylaniline | | CAS: | 415941-58-1 | | MF: | C16H28NP | | MW: | 265.37 | | EINECS: | | | Product Categories: | | | Mol File: | 415941-58-1.mol |  |
| | Di-tert-butyl(2-dimethylaminophenyl)phosphine Chemical Properties |
| Melting point | 50-53°C | | Boiling point | 342.1±25.0 °C(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | pka | 4.78±0.18(Predicted) | | form | crystal | | color | white to light-brown | | InChI | 1S/C16H28NP/c1-15(2,3)18(16(4,5)6)14-12-10-9-11-13(14)17(7)8/h9-12H,1-8H3 | | InChIKey | NTJPAGHACOIILD-UHFFFAOYSA-N | | SMILES | CN(C)c1ccccc1P(C(C)(C)C)C(C)(C)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Di-tert-butyl(2-dimethylaminophenyl)phosphine Usage And Synthesis |
| Reaction |
- Ligand for the Copper-Catalyzed Suzuki-Miyaura Coupling of Arylboronate Esters and Aryl Iodides
- Ligand for the Copper-Catalyzed Coupling of Triaryl- and Trialkylindium reagents with Aryl Iodides and Bromides
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | Di-tert-butyl(2-dimethylaminophenyl)phosphine Preparation Products And Raw materials |
|