Propargyl-succinimidyl-ester manufacturers
- Propargyl-PEG1-NHS
-
- $0.00 / 1g
-
2026-02-05
- CAS:1174157-65-3
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
|
| | Propargyl-succinimidyl-ester Basic information |
| Product Name: | Propargyl-succinimidyl-ester | | Synonyms: | Propargyl-N-hydroxysuccinimidyl ester;Propargyl-succinimidyl-ester;2,5-Dioxopyrrolidin-1-yl 3-(prop-2-ynyloxy)propanoate;3-(2-Propyn-1-yloxy)propanoic acid 2,5-dioxo-1-pyrrolidinyl ester;Alkyne-NHS ester;N-Succinimidyl 3-(propargyloxy)propionate;Propargyl-NHS Ester;Propargyl-PEG1-NHS este | | CAS: | 1174157-65-3 | | MF: | C10H11NO5 | | MW: | 225.2 | | EINECS: | | | Product Categories: | | | Mol File: | 1174157-65-3.mol |  |
| | Propargyl-succinimidyl-ester Chemical Properties |
| Melting point | 36-41°C | | Boiling point | 351.2±48.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO, DCM, DMF | | form | Solid | | color | Gray | | Appearance | White solid | | Water Solubility | Slightly soluble in water. | | InChI | 1S/C10H11NO5/c1-2-6-15-7-5-10(14)16-11-8(12)3-4-9(11)13/h1H,3-7H2 | | InChIKey | WKIKHHMUNOVQLD-UHFFFAOYSA-N | | SMILES | C#CCOCCC(ON1C(CCC1=O)=O)=O |
| WGK Germany | 3 | | HS Code | 29280000 | | Storage Class | 11 - Combustible Solids |
| | Propargyl-succinimidyl-ester Usage And Synthesis |
| Description | Propargyl-PEG1-NHS ester is an amine reactive reagent that can be used for derivatizing peptides, antibodies, amine coated surfaces etc. The alkyne group reacts with azide-bearing compounds or biomolecules in copper catalyzed Click Chemistry reactions. | | Uses | N-Succinimidyl 3-(propargyloxy)propionate is an acetylene-containing reagent with NHS ester functionality for reaction with amines. | | Uses | Propargyl-N-hydroxysuccinimidyl ester may be used as a tool for identifying nucleophilic ligandable hotspots by chemoproteomic approaches. | | reaction suitability | reaction type: click chemistry
reagent type: cross-linking reagent | | IC 50 | Non-cleavable Linker |
| | Propargyl-succinimidyl-ester Preparation Products And Raw materials |
|