| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 5-[(4-Methylphenyl)sulfonyl]-3-oxopentanoic acid ethyl ester Basic information |
| | 5-[(4-Methylphenyl)sulfonyl]-3-oxopentanoic acid ethyl ester Chemical Properties |
| Melting point | 42-46°C | | Boiling point | 463.9±45.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | Fp | >110℃ | | pka | 10.15±0.46(Predicted) | | form | solid | | InChI | 1S/C14H18O5S/c1-3-19-14(16)10-12(15)8-9-20(17,18)13-6-4-11(2)5-7-13/h4-7H,3,8-10H2,1-2H3 | | InChIKey | APRUPJUUTCSBAE-UHFFFAOYSA-N | | SMILES | CCOC(=O)CC(=O)CCS(=O)(=O)c1ccc(C)cc1 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | nwg | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | 5-[(4-Methylphenyl)sulfonyl]-3-oxopentanoic acid ethyl ester Usage And Synthesis |
| Uses | Ethyl 5-[(4-methylphenyl)sulfonyl]-3-oxopentanoate can be used as a reactant to prepare:
- Ethyl 3-oxopent-4-enoate (Nazarov′s reagent) via base-induced β-elimination reaction. Nazarov′s reagent can be employed as an anulating agent in Robinson annulation of cyclic β-diketones and cycloalkanones.
- γ-pyrones via triflic anhydride-mediated electrophilic condensation reaction.
| | reaction suitability | reaction type: C-C Bond Formation |
| | 5-[(4-Methylphenyl)sulfonyl]-3-oxopentanoic acid ethyl ester Preparation Products And Raw materials |
|