4-IODO-2-(METHYLTHIO)PYRIMIDINE manufacturers
|
| | 4-IODO-2-(METHYLTHIO)PYRIMIDINE Basic information | | Uses |
| | 4-IODO-2-(METHYLTHIO)PYRIMIDINE Chemical Properties |
| Melting point | 45-47 °C | | Boiling point | 307.0±15.0 °C(Predicted) | | density | 2.00±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | form | solid | | pka | -0.59±0.20(Predicted) | | color | Brown | | InChI | InChI=1S/C5H5IN2S/c1-9-5-7-3-2-4(6)8-5/h2-3H,1H3 | | InChIKey | SECBGKYJKCNDID-UHFFFAOYSA-N | | SMILES | C1(SC)=NC=CC(I)=N1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 4-IODO-2-(METHYLTHIO)PYRIMIDINE Usage And Synthesis |
| Uses | 4-iodo-2-(methylthio)pyrimidine is a useful research chemical. |
| | 4-IODO-2-(METHYLTHIO)PYRIMIDINE Preparation Products And Raw materials |
|