|
|
| | (1R,2R)-(-)-TRANS-1-AMINO-2-INDANOL Basic information |
| Product Name: | (1R,2R)-(-)-TRANS-1-AMINO-2-INDANOL | | Synonyms: | (1R,2R)-(-)-TRANS-1-AMINO-2-INDANOL;(1R,2R)-1-AMINO-2,3-DIHYDRO-1H-INDEN-2-OL;(1R,2R)-(-)-trans-1-AMino-2-indanol 97%;(1R,2R)-(-)-1-Amino-2-indanol;(1R,2R)-1-Amino-2-hydroxyindane;(1R,2R)-1-Amino-2-indanol;(1R,2R)-(-)-1-Amino-2-hydroxyindan;(1R,2R)-(-)-1-Amino-2-indanol > | | CAS: | 163061-73-2 | | MF: | C9H11NO | | MW: | 149.19 | | EINECS: | | | Product Categories: | API intermediates;Amino Alcohols;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 163061-73-2.mol |  |
| | (1R,2R)-(-)-TRANS-1-AMINO-2-INDANOL Chemical Properties |
| Melting point | 142-146 °C | | Boiling point | 290.0±40.0 °C(Predicted) | | density | 1.212±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 14.79±0.40(Predicted) | | form | powder to crystal | | color | White to Light yellow to Dark green | | Optical Rotation | [α]/D -23.0°, c = 1 in ethanol | | InChI | 1S/C9H11NO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9,11H,5,10H2/t8-,9-/m1/s1 | | InChIKey | LOPKSXMQWBYUOI-RKDXNWHRSA-N | | SMILES | N[C@H]1[C@H](O)Cc2ccccc12 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2922190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (1R,2R)-(-)-TRANS-1-AMINO-2-INDANOL Usage And Synthesis |
| Uses | (1R,2R)-()-trans-1-Amino-2-indanol has been used as a starting material to prepare an indene-based chiral auxiliary, which is used in the aldol reaction. It can also be used as:
- A starting material in the synthesis of oxazoline-alcohol ligands, which are employed in the asymmetric addition reaction of diethylzinc to aldehydes.
- A chiral test compound in the study of enantiomeric separation of chiral primary amines using supercritical fluid chromatography (SFC) and HPLC.
|
| | (1R,2R)-(-)-TRANS-1-AMINO-2-INDANOL Preparation Products And Raw materials |
|