| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-Methyl-3,4,5-trimethoxybenzylamine Basic information |
| Product Name: | N-Methyl-3,4,5-trimethoxybenzylamine | | Synonyms: | N-Methyl-1-(3,4,5-triMethoxyphenyl)MethanaMine;N-methyl-1-(3,4,5-trimethoxyphenyl)methanamine hydrochloride;N-(3-Oxopropyl)acetamide;methyl-[(3,4,5-trimethoxyphenyl)methyl]ammonium;Benzenemethanamine, 3,4,5-trimethoxy-N-methyl-;N-Methyl-3,4,5-trimethoxybenzylamine | | CAS: | 58780-82-8 | | MF: | C11H17NO3 | | MW: | 211.26 | | EINECS: | | | Product Categories: | | | Mol File: | 58780-82-8.mol |  |
| | N-Methyl-3,4,5-trimethoxybenzylamine Chemical Properties |
| Boiling point | 91 °C(Press: 0.05 Torr) | | density | 1.040±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder | | pka | 9.01±0.10(Predicted) | | InChI | 1S/C11H17NO3/c1-12-7-8-5-9(13-2)11(15-4)10(6-8)14-3/h5-6,12H,7H2,1-4H3 | | InChIKey | LFULMNRPABTDDQ-UHFFFAOYSA-N | | SMILES | COC1=C(OC)C(OC)=CC(CNC)=C1 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | N-Methyl-3,4,5-trimethoxybenzylamine Usage And Synthesis |
| | N-Methyl-3,4,5-trimethoxybenzylamine Preparation Products And Raw materials |
|