|
|
| | 5-(4-Methylbenzyl)-1,3,4-oxadiazol-2-amine Basic information |
| | 5-(4-Methylbenzyl)-1,3,4-oxadiazol-2-amine Chemical Properties |
| Boiling point | 370.7±45.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | pka | -0.71±0.13(Predicted) | | form | solid | | InChI | 1S/C10H11N3O/c1-7-2-4-8(5-3-7)6-9-12-13-10(11)14-9/h2-5H,6H2,1H3,(H2,11,13) | | InChIKey | ZTXKJBOGRBCZLO-UHFFFAOYSA-N | | SMILES | NC1=NN=C(CC2=CC=C(C)C=C2)O1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-(4-Methylbenzyl)-1,3,4-oxadiazol-2-amine Usage And Synthesis |
| | 5-(4-Methylbenzyl)-1,3,4-oxadiazol-2-amine Preparation Products And Raw materials |
|