- 3-Dimethylaminoacrolein
-
- $8.00 / 1KG
-
2025-09-25
- CAS:927-63-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| Product Name: | 3-Dimethylaminoacrolein | | Synonyms: | (2E)-3-(Dimethylamino)-2-propenal;2-Propenal, 3-(dimethylamino)-;beta-(Dimethylamino)acrolein;n,n-dimethylamino-2-propen-3-al;3-(DIMETHYLAMINO)ACROLEIN;3-DIMETHYLAMINOACRYLALDEHYDE;(E)-3-(DIMETHYLAMINO)ACRYLALDEHYDE;(2E)-3-(DIMETHYLAMINO)PROP-2-ENAL | | CAS: | 927-63-9 | | MF: | C5H9NO | | MW: | 99.13 | | EINECS: | 213-157-7 | | Product Categories: | C1 to C6;Aldehydes;Carbonyl Compounds | | Mol File: | 927-63-9.mol |  |
| | 3-Dimethylaminoacrolein Chemical Properties |
| Boiling point | 270-273 °C(lit.) | | density | 0.99 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.584(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 6.79±0.70(Predicted) | | form | Liquid | | color | Clear yellow to brown | | BRN | 969389 | | InChI | InChI=1S/C5H9NO/c1-6(2)4-3-5-7/h3-5H,1-2H3 | | InChIKey | RRLMPLDPCKRASL-UHFFFAOYSA-N | | SMILES | C(=O)C=CN(C)C | | CAS DataBase Reference | 927-63-9(CAS DataBase Reference) | | NIST Chemistry Reference | N,N-Dimethylamino-2-propen-3-al(927-63-9) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3267 8/PG 2 | | WGK Germany | 3 | | F | 8-19 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29223990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3-Dimethylaminoacrolein Usage And Synthesis |
| Description | 3-Dimethylaminoacrolein is an organic compound with the formula Me2NC(H)=CHCHO. It is a pale yellow water-soluble liquid. The compound has a number of useful and unusual properties, e.g. it causes a reversal of the hypnotic effect of morphine in miceand has astimulating effect in humans. | | Uses | 3-Dimethylaminoacrolein was used in synthesis of:
- benzochlorins, benzoisobacteriochlorins and benzobacteriochlorins
- styryl-substituted Z/E-chlorin derivatives with chlorophyll-a skeleton
- Y shaped cyanines having dimethylamino end groups
| | Synthesis | 3-Dimethylaminoacrylaldehyde can be regarded as an amino-substituted unsaturated aldehyde compound, which can be prepared from N,N-dimethylformamide and ethyl alkenyl ether by condensation reaction. |
| | 3-Dimethylaminoacrolein Preparation Products And Raw materials |
|