- L-2-THIENYLALANINE
-
- $100.00 / 1KG
-
2019-07-06
- CAS:22951-96-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: Customized
|
| | L-2-THIENYLALANINE Basic information |
| | L-2-THIENYLALANINE Chemical Properties |
| Melting point | 255-263 °C (dec.) (lit.)
~260 °C (dec.) | | alpha | -31.5 º (C=1% IN H2O) | | Boiling point | 315.9±32.0 °C(Predicted) | | density | 1.349±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | pka | 2.15±0.10(Predicted) | | form | Solid | | color | Off-white | | Optical Rotation | [α]20/D 30.5±1.5°, c = 1% in H2O | | Water Solubility | Slightly soluble in water. | | BRN | 82872 | | Major Application | peptide synthesis | | InChI | InChI=1/C7H9NO2S/c8-6(7(9)10)4-5-2-1-3-11-5/h1-3,6H,4,8H2,(H,9,10)/t6-/s3 | | InChIKey | WTOFYLAWDLQMBZ-LURJTMIESA-N | | SMILES | C(C1SC=CC=1)[C@H](N)C(=O)O |&1:6,r| | | CAS DataBase Reference | 22951-96-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | L-2-THIENYLALANINE Usage And Synthesis |
| Chemical Properties | Off-white crystals | | Uses | 3-(2-Thienyl)-L-alanine can be used in agrochemical, pharmaceutical and dyestuff field. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | L-2-THIENYLALANINE Preparation Products And Raw materials |
|