| Company Name: |
Changzhou Hopschain Chemical Co.,Ltd.
|
| Tel: |
85528066 13775048983 |
| Email: |
sales@hopschem.com |
| Products Intro: |
Product Name:2,3-Difluoro-6-methoxybenzyl alcohol
CAS:773871-99-1
Purity:95+% Package:1g;5g;10g
|
| Company Name: |
Shanghai Chaolan Chemical Technology Center
|
| Tel: |
QQ：65489617 19372819560 |
| Email: |
Sales@ATKchemical.com |
| Products Intro: |
Product Name:2,3-Difluoro-6-methoxybenzyl alcohol
CAS:773871-99-1
Purity:98 Package:1G,5G,10G,50G,100G,500G
|
|
| | 2,3-DIFLUORO-6-METHOXYBENZYL ALCOHOL Basic information |
| | 2,3-DIFLUORO-6-METHOXYBENZYL ALCOHOL Chemical Properties |
| Boiling point | 229.2±35.0 °C(Predicted) | | density | 1.283±0.06 g/cm3(Predicted) | | pka | 13.61±0.10(Predicted) | | InChI | InChI=1S/C8H8F2O2/c1-12-7-3-2-6(9)8(10)5(7)4-11/h2-3,11H,4H2,1H3 | | InChIKey | TYTZXKDHCJTELI-UHFFFAOYSA-N | | SMILES | C1(CO)=C(OC)C=CC(F)=C1F |
| | 2,3-DIFLUORO-6-METHOXYBENZYL ALCOHOL Usage And Synthesis |
| | 2,3-DIFLUORO-6-METHOXYBENZYL ALCOHOL Preparation Products And Raw materials |
|