- 2,4-Diphenylimidazole
-
- $0.00 / 1KG
-
2025-06-27
- CAS:670-83-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- 2,4-Diphenylimidazole
-
- $20.00 / 1kg
-
2025-06-20
- CAS:670-83-7
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10 tons
- 2,4-Diphenylimidazole
-
- $15.00 / 1KG
-
2021-07-13
- CAS:670-83-7
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 2,4-Diphenylimidazole Basic information | | Uses |
| | 2,4-Diphenylimidazole Chemical Properties |
| Melting point | 164-166 °C(Solv: ethanol (64-17-5)) | | Boiling point | 461.2±14.0 °C(Predicted) | | density | 1.149±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 12.39±0.10(Predicted) | | color | Off-white | | InChI | InChI=1S/C15H12N2/c1-3-7-12(8-4-1)14-11-16-15(17-14)13-9-5-2-6-10-13/h1-11H,(H,16,17) | | InChIKey | FHHCKYIBYRNHOZ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)NC(C2=CC=CC=C2)=CN=1 |
| Hazard Codes | Xi | | HS Code | 2933299090 |
| | 2,4-Diphenylimidazole Usage And Synthesis |
| Uses | 2,4-Diphenylimidazole is an organic intermediate used in synthesis and pharmaceutical research. Furthermore, current research is exploring the applications of imidazole derivatives in the development of novel materials. For example, some studies have investigated the potential of imidazole derivatives as components of ionic liquids, which are salts with unique properties such as high thermal stability and electrical conductivity. |
| | 2,4-Diphenylimidazole Preparation Products And Raw materials |
|