| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Methyl-5-(trifluoromethyl)benzaldehyde Basic information | | Uses |
| | 2-Methyl-5-(trifluoromethyl)benzaldehyde Chemical Properties |
| Boiling point | 201.0±35.0 °C(Predicted) | | density | 1.246±0.06 g/cm3(Predicted) | | refractive index | 1.4750 | | storage temp. | Storage temp. 2-8°C | | form | liquid | | color | Colourless/Clear | | Sensitive | Air Sensitive | | InChI | 1S/C9H7F3O/c1-6-2-3-8(9(10,11)12)4-7(6)5-13/h2-5H,1H3 | | InChIKey | XFIZZVVBLXLTOD-UHFFFAOYSA-N | | SMILES | CC1=CC=C(C(F)(F)F)C=C1C=O |
| HazardClass | IRRITANT | | HS Code | 2913000090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-Methyl-5-(trifluoromethyl)benzaldehyde Usage And Synthesis |
| Uses | 2-Methyl-5-(trifluoromethyl)benzaldehyde is an aldehyde organic compound that can be used as a pharmaceutical intermediate. |
| | 2-Methyl-5-(trifluoromethyl)benzaldehyde Preparation Products And Raw materials |
|