- FMOC-D-GLN-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:112898-00-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | FMOC-D-GLN-OH Basic information |
| Product Name: | FMOC-D-GLN-OH | | Synonyms: | FMOC-D-GLN;(2R)-5-amino-2-[[9H-fluoren-9-ylmethoxy(oxo)methyl]amino]-5-oxopentanoic acid;FMOC-D-GLN-OH;FMOC-D-GLUTAMINE;9-FLUORENYLMETHOXYCARBONYL-D-GLUTAMINE;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-D-GLUTAMINE;N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-D-GLUTAMINE;N-ALPHA-FMOC-D-GLUTAMINE | | CAS: | 112898-00-7 | | MF: | C20H20N2O5 | | MW: | 368.38 | | EINECS: | | | Product Categories: | | | Mol File: | 112898-00-7.mol |  |
| | FMOC-D-GLN-OH Chemical Properties |
| Boiling point | 699.8±55.0 °C(Predicted) | | density | 1.332 | | storage temp. | 2-8°C | | form | Powder | | pka | 3.73±0.10(Predicted) | | color | White | | Major Application | peptide synthesis | | InChI | 1S/C20H20N2O5/c21-18(23)10-9-17(19(24)25)22-20(26)27-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11H2,(H2,21,23)(H,22,26)(H,24,25)/t17-/m1/s1 | | InChIKey | IZKGGDFLLNVXNZ-QGZVFWFLSA-N | | SMILES | NC(=O)CC[C@@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | Storage Class | 11 - Combustible Solids |
| | FMOC-D-GLN-OH Usage And Synthesis |
| Chemical Properties | White crystals | | Uses | N2-Fmoc-D-glutamine is an N-Fmoc-protected form of D-Glutamine (G597295). D-Glutamine is an unnatural isomer of L-Glutamine (G597000) that is present in human plasma an is a source of liberated ammonia. D-Glutamine can be synthesized by enzymatic means or can be found in cheeses, wine and vinegars as well. It is often used to determine the activity of Glutamine synthetase, an enzyme that is commonly found in the mammalian liver and brain that controls the use of nitrogen in cells. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-D-GLN-OH Preparation Products And Raw materials |
|