1-Methylcyclopropanemethanol manufacturers
|
| | 1-Methylcyclopropanemethanol Basic information |
| Product Name: | 1-Methylcyclopropanemethanol | | Synonyms: | (1-Methylcyclopropyl)methanol;1-METHYLCYCLOPROPANEMETHANOL;Cyclopropanemethanol,1-methyl-;(1-Methylcyclopropyl)Methanol 2-chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride;1-MethylcyclopropaneMethanol 98%;1-Methylcyclopropanemethanol ISO 9001：2015 REACH;1-Methylcyclopropanemethanol | | CAS: | 2746-14-7 | | MF: | C5H10O | | MW: | 86.13 | | EINECS: | | | Product Categories: | Alcohols;C2 to C6;Oxygen Compounds | | Mol File: | 2746-14-7.mol |  |
| | 1-Methylcyclopropanemethanol Chemical Properties |
| Melting point | -15.1°C | | Boiling point | 128 °C/750 mmHg (lit.) | | density | 0.887 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.431(lit.) | | Fp | 93 °F | | storage temp. | Storage temp. 2-8°C | | pka | 15.10±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C5H10O/c1-5(4-6)2-3-5/h6H,2-4H2,1H3 | | InChIKey | PIZQWRXTMGASCZ-UHFFFAOYSA-N | | SMILES | C1(C)(CO)CC1 | | LogP | 0.720 (est) | | NIST Chemistry Reference | 1-Methylcyclopropanemethanol(2746-14-7) |
| Risk Statements | 10 | | Safety Statements | 16-29-33 | | RIDADR | UN 1987 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3.2 | | PackingGroup | III |
| | 1-Methylcyclopropanemethanol Usage And Synthesis |
| Uses | 1-Methylcyclopropanemethanol has been used in the preparation of (±)-2-(benzyloxycarbonylamino)-2-(1′-methylcyclopropyl)ethanamide. | | General Description | Kinetics of gas-phase thermal decomposition of methylcyclopropanemethanol has been reported. |
| | 1-Methylcyclopropanemethanol Preparation Products And Raw materials |
|