| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
ChemCollect GmbH |
| Tel: |
+49 (0) 202 4690049 |
| Email: |
contact@chemcollect.de |
|
| | 2-(2-Ethoxy-ethyl)-3-oxo-2,3-dihydro-1H-isoindole-4-carboxylic acid Basic information |
| | 2-(2-Ethoxy-ethyl)-3-oxo-2,3-dihydro-1H-isoindole-4-carboxylic acid Chemical Properties |
| form | solid | | InChI | 1S/C13H15NO4/c1-2-18-7-6-14-8-9-4-3-5-10(13(16)17)11(9)12(14)15/h3-5H,2,6-8H2,1H3,(H,16,17) | | InChIKey | UZXNAGHXXUULRB-UHFFFAOYSA-N | | SMILES | O=C(O)C1=CC=CC2=C1C(N(CCOCC)C2)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 2-(2-Ethoxy-ethyl)-3-oxo-2,3-dihydro-1H-isoindole-4-carboxylic acid Usage And Synthesis |
| | 2-(2-Ethoxy-ethyl)-3-oxo-2,3-dihydro-1H-isoindole-4-carboxylic acid Preparation Products And Raw materials |
|