| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Phenacetin-ethoxy-1-13C Basic information |
| Product Name: | Phenacetin-ethoxy-1-13C | | Synonyms: | ACETOPHENETIDIN (ETHOXY-1-13C);N-[4-ETHOXYPHENYL]ACETAMIDE (ETHOXY-1-13C);P-ACETOPHENETIDIDE-ETHOXY-1-13C;PHENACETIN-ETHOXY-2-13C, 99 ATOM % 13C;n-(4-ethoxy-2-13c-phenyl)acetamide;phenacetin-13c1(ethoxy-2-13c);Phenacetin-ethoxy-2-13C;Phenacetin-ethoxy-1-13C | | CAS: | 286425-41-0 | | MF: | C10H13NO2 | | MW: | 180.22 | | EINECS: | | | Product Categories: | | | Mol File: | 286425-41-0.mol |  |
| | Phenacetin-ethoxy-1-13C Chemical Properties |
| Melting point | 134-136 °C(lit.) | | Fp | 86℃ | | InChI | 1S/C10H13NO2/c1-3-13-10-6-4-9(5-7-10)11-8(2)12/h4-7H,3H2,1-2H3,(H,11,12)/i1+1 | | InChIKey | CPJSUEIXXCENMM-OUBTZVSYSA-N | | SMILES | CC(=O)Nc1ccc(OC[13CH3])cc1 |
| Hazard Codes | T,Xn | | Risk Statements | 45-46-20/21/22-36/38-21/22 | | Safety Statements | 53-22-36/37/39-45-36/37-28-26 | | RIDADR | UN 2937 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | Phenacetin-ethoxy-1-13C Usage And Synthesis |
| | Phenacetin-ethoxy-1-13C Preparation Products And Raw materials |
|