| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | CRESYL VIOLET PERCHLORATE Basic information |
| Product Name: | CRESYL VIOLET PERCHLORATE | | Synonyms: | CRESYL VIOLET PERCHLORATE;OXAZINE 9 PERCHLORATE;Cresyl violet perchlorate, 98&percnt:;Cresyl violet *CAS 41830-80-2*;5,9-diamino-benzo[a]phenoxazin-7-iuperchlorate;5,9-diaminobenzo[a]phenoxazin-7-ium perchlorate;CRESYL VIOLET PERCHLORATE, FOR FLUORESCE NCE;Cresylvioletperchlorate,lasergrade | | CAS: | 41830-80-2 | | MF: | C16H12ClN3O5 | | MW: | 361.74 | | EINECS: | 255-561-6 | | Product Categories: | | | Mol File: | 41830-80-2.mol |  |
| | CRESYL VIOLET PERCHLORATE Chemical Properties |
| density | 1.4795 (rough estimate) | | refractive index | 1.6500 (estimate) | | storage temp. | room temp | | form | Powder | | color | Green | | λmax | 602 nm | | ε(extinction coefficient) | ≥27000 at 267-273nm
≥50000 at 599-605nm
≥7000 at 316-322nm | | Stability: | Stable. Incompatible with strong oxidizing agents. Hygroscopic. | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C16H11N3O.ClHO4/c17-9-5-6-13-14(7-9)20-15-8-12(18)10-3-1-2-4-11(10)16(15)19-13;2-1(3,4)5/h1-8,17H,18H2;(H,2,3,4,5) | | InChIKey | YZUJISGZMSLVAU-UHFFFAOYSA-N | | SMILES | OCl(=O)(=O)=O.Nc1cc2OC3=CC(=N)C=CC3=Nc2c4ccccc14 | | EPA Substance Registry System | Benzo[a]phenoxazin-7-ium, 5,9-diamino-, perchlorate (41830-80-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-4.10 | | TSCA | TSCA listed | | HS Code | 32041900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | CRESYL VIOLET PERCHLORATE Usage And Synthesis |
| Description | Cresyl violet 670 Perchlorate is a biomedical product used in research and diagnostics. It is a fluorescent stain that selectively binds to RNA and DNA. Widely employed in histology and cytology, it aids in identifying cell nuclei and nucleic acids. This stain plays a crucial role in studying the effects, structure, and progression of diseases like cancer and neurological disorders. | | Chemical Properties | dark green crystals | | Uses | Among its many applications, Cresyl Violet can be used to stain for Nissl substance and nuclei in nervous tissue and the identification of Helicobacter. Cresyl Violet perchlorate has been used to make cresyl violet perchlorate-polymer composite thin films. It also has been used as a fluorescence standard. | | Definition | ChEBI: Cresyl violet perchlorate is an organic perchlorate salt. It has a role as a fluorochrome. It contains a cresyl violet. | | General Description | Cresyl Violet perchlorate, also known as oxazine 9, is a laser dye. Cresyl violet is a small diaminobenzooxazine with a moderately sized planar conjugated system. |
| | CRESYL VIOLET PERCHLORATE Preparation Products And Raw materials |
|