|
|
| | 1,4-DIBROMO-2-FLUOROBENZENE Basic information |
| | 1,4-DIBROMO-2-FLUOROBENZENE Chemical Properties |
| Melting point | 33-36 °C (lit.) | | Boiling point | 216 °C (lit.) | | density | 2.0491 (rough estimate) | | refractive index | 1.5770 (estimate) | | Fp | 215 °F | | storage temp. | Sealed in dry,Room Temperature | | form | powder to lump to clear liquid | | color | White or Colorles to Yellow to Orange | | Water Solubility | Insoluble in water. | | FreezingPoint | 32.0 to 34.0 ℃ | | BRN | 3236451 | | InChI | InChI=1S/C6H3Br2F/c7-4-1-2-5(8)6(9)3-4/h1-3H | | InChIKey | WNSNPGHNIJOOPM-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(Br)C=C1F | | CAS DataBase Reference | 1435-52-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,4-DIBROMO-2-FLUOROBENZENE Usage And Synthesis |
| Chemical Properties | white crystalline mass | | Uses | 1,4-Dibromo-2-fluorobenzene was used in preparation of 1,4-bis(2-hydroxy-2-methyl-3-butynyl)-2-fluorobenzene. | | General Description | The Suzuki-Miyaura reaction of 1,4-dibromo-2-fluorobenzene with arylboronic acids yields fluorinated para-terphenyls. |
| | 1,4-DIBROMO-2-FLUOROBENZENE Preparation Products And Raw materials |
|