N2-(1-Oxohexyl)-L-lysylglycyl-L-histidyl-L-lysinamide acetate (1:) manufacturers
|
| | N2-(1-Oxohexyl)-L-lysylglycyl-L-histidyl-L-lysinamide acetate (1:) Basic information |
| Product Name: | N2-(1-Oxohexyl)-L-lysylglycyl-L-histidyl-L-lysinamide acetate (1:) | | Synonyms: | N2-(1-Oxohexyl)-L-lysylglycyl-L-histidyl-L-lysinamide acetate (1:);Caprooyl-Tetrapeptide-3;N2-(1-oxohexyl)-L-lysylglycyl-L-histidyl-L-lysinamide;N2-(1-OXOHEXYL)-L-LYSYLGLYCYL-L-HISTIDYL-L-LYSINAMIDE; ACETATE;Caprooyl Tetrapeptide-3 (acetate);L-Lysinamide,N2-(1-oxohexyl)-L-lysylglycyl-L-histidyl-,acetate(1:?);Caprooyl-Tetrapeptide-3 (Reference:ChroNOline);CaprooyI Tetrapeptide-3 | | CAS: | 1012317-71-3 | | MF: | C28H51N9O7 | | MW: | 625.77 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 1012317-71-3.mol |  |
| | N2-(1-Oxohexyl)-L-lysylglycyl-L-histidyl-L-lysinamide acetate (1:) Chemical Properties |
| solubility | DMF: 25 mg/ml; DMSO: 25 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS (pH 7.2) (1:3): 0.25 mg/ml | | form | A crystalline solid | | Sequence | {hexanoyl-Lys}-Gly-His-Lys-NH2 | | Cosmetics Ingredients Functions | SKIN PROTECTING | | InChIKey | UAAVFMYNDSZDNL-AHTLUFSANA-N | | SMILES | C(=O)(O)C.[C@@H](NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)CCCCC)(C(=O)N[C@H](C(=O)N)CCCCN)CC1NC=NC=1 |&1:4,12,29,r| |
| | N2-(1-Oxohexyl)-L-lysylglycyl-L-histidyl-L-lysinamide acetate (1:) Usage And Synthesis |
| Uses | Caprooyl-tetrapeptide-3 acetate is used for fine lines and wrinkle reduction. Caprooyl-tetrapeptide-3 acetate stimulates the expression of collagen VII and laminin-5 in a model of corticoid-induced skin ageing[1]. | | References | [1] Leonard M. Patt, Ph.D., et al. Neova Power Defense Combines Biomimetic Peptides with Copper Technology. Power Defense. |
| | N2-(1-Oxohexyl)-L-lysylglycyl-L-histidyl-L-lysinamide acetate (1:) Preparation Products And Raw materials |
|