TRINONANOIN manufacturers
- Tripelargonin
-
- $113.00 / 50mg
-
2026-04-20
- CAS:126-53-4
- Min. Order:
- Purity:
- Supply Ability: 10g
- TRINONANOIN
-
- $0.00 / 25kg
-
2025-12-02
- CAS:126-53-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000
|
| | TRINONANOIN Basic information |
| Product Name: | TRINONANOIN | | Synonyms: | glyceroltrinonanoate;TRIPELARGONIN;TRINONANOIN;GLYCEROL TRIPELARGONATE;GLYCERYL TRINONANOATE;GLYCERYL TRINONYLATE;GLYCERINTRIPELARGONATE;1,2,3-Trinonanoylglycerol | | CAS: | 126-53-4 | | MF: | C30H56O6 | | MW: | 512.76 | | EINECS: | 204-791-5 | | Product Categories: | | | Mol File: | 126-53-4.mol |  |
| | TRINONANOIN Chemical Properties |
| Melting point | 8-9 °C | | density | 0.943 g/mL at 20 °C (lit.) | | vapor pressure | 0.001Pa at 25℃ | | refractive index | n20/D 1.449 | | storage temp. | −20°C | | solubility | DMF: 20mg/mL; DMSO: 20mg/mL; Ethanol: 25mg/mL | | Boiling point | 544.1±17.0 °C(Predicted) | | form | A liquid | | Water Solubility | 93.4μg/L at 20℃ | | BRN | 1809503 | | Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT
SKIN CONDITIONING | | InChI | 1S/C30H56O6/c1-4-7-10-13-16-19-22-28(31)34-25-27(36-30(33)24-21-18-15-12-9-6-3)26-35-29(32)23-20-17-14-11-8-5-2/h27H,4-26H2,1-3H3 | | InChIKey | YRIMSXJXBHUHJT-UHFFFAOYSA-N | | SMILES | CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC)OC(=O)CCCCCCCC | | LogP | 10.68 at 25℃ |
| WGK Germany | 3 | | RTECS | RA7005000 | | Storage Class | 10 - Combustible liquids |
| | TRINONANOIN Usage And Synthesis |
| Uses | Trinonanoin is an analog of Tricaproin (T773780) which is used as a delivery system for Paclitaxel (P132500), an anticancer agent. | | Flammability and Explosibility | Not classified |
| | TRINONANOIN Preparation Products And Raw materials |
|