|
|
| | 3-Quinolinecarboxylic acid Basic information |
| | 3-Quinolinecarboxylic acid Chemical Properties |
| Melting point | 277-280 °C (lit.) | | Boiling point | 303.81°C (rough estimate) | | density | 1.2427 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Powder | | pka | 2.20±0.30(Predicted) | | color | White to slightly beige | | BRN | 126542 | | InChI | InChI=1S/C10H7NO2/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8/h1-6H,(H,12,13) | | InChIKey | DJXNJVFEFSWHLY-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2)C=C(C(O)=O)C=1 | | CAS DataBase Reference | 6480-68-8(CAS DataBase Reference) |
| | 3-Quinolinecarboxylic acid Usage And Synthesis |
| Chemical Properties | WHITE TO SLIGHTLY BEIGE POWDER | | Uses | A quinoline derivative with antimicrobial activity. | | General Description | The antibacterial activity of 3-quinolinecarboxylic acid derivatives were evaluated. | | Synthesis | In a Schlenk (50 mL) reaction flask with a carbon dioxide balloon attached at the stub, Cu(OAc)2.H2O (0.0125 mmol), 1,2-bis(diphenylphosphino)benzene (0.018 mmol), and 1,4-dioxane (2.0 mL) were added with stirring, and then the flask was placed at 60 C oil bath for 25 min under carbon dioxide atmosphere, followed by the sequential addition of toluene (8 mL), 3-bromoquinoline (1.0 mmol), Pd(OAc)2 (0.03 mmol), 4,5-bis(diphenylphosphino)-9,9-dimethyloxanthene (0.06 mmol), Et3N (2.5 mmol, 2.5 equiva.) and then Carbon dioxide was removed and the reaction was carried out at 100 C until the raw material bromobenzene disappeared, cooled to room temperature and then sodium hydroxide solution (1M, 10.0 mL) was added, stirred for 10 min and then filtered, the solids were washed with water for 3 times, the filtrate was extracted with ethyl acetate (2 x 10 mL) leaving an aqueous layer, the aqueous layer was adjusted to pH 1-2 with hydrochloric acid solution (1 M), extracted with ethyl acetate (3 x 15 mL) and Anhydrous sodium sulfate was dried, and the solvent was removed to obtain quinoline-3-carboxylic acid in 98% yield. |
| | 3-Quinolinecarboxylic acid Preparation Products And Raw materials |
|