|
| 3-Quinolinecarboxylic acid Basic information |
| 3-Quinolinecarboxylic acid Chemical Properties |
Melting point | 277-280 °C (lit.) | Boiling point | 303.81°C (rough estimate) | density | 1.2427 (rough estimate) | refractive index | 1.5200 (estimate) | storage temp. | Inert atmosphere,Room Temperature | solubility | DMSO (Slightly), Methanol (Slightly) | form | Powder | pka | 2.20±0.30(Predicted) | color | White to slightly beige | BRN | 126542 | InChI | InChI=1S/C10H7NO2/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8/h1-6H,(H,12,13) | InChIKey | DJXNJVFEFSWHLY-UHFFFAOYSA-N | SMILES | N1C2C(=CC=CC=2)C=C(C(O)=O)C=1 | CAS DataBase Reference | 6480-68-8(CAS DataBase Reference) |
| 3-Quinolinecarboxylic acid Usage And Synthesis |
Chemical Properties | WHITE TO SLIGHTLY BEIGE POWDER | Uses | A quinoline derivative with antimicrobial activity. | General Description | The antibacterial activity of 3-quinolinecarboxylic acid derivatives were evaluated. |
| 3-Quinolinecarboxylic acid Preparation Products And Raw materials |
|