|
|
| | Polyoxyethylene dioleate ether Basic information |
| Product Name: | Polyoxyethylene dioleate ether | | Synonyms: | o,o'-dioleoylpolyethylene glycol 400;Polyethylenglykoldioleat, EO 9- mol;.alpha.-(1-oxo-9-octadecenyl)-.omega.-[(1-oxo-9-octadecenyl)oxy]-, (Z,Z)-Poly(oxy-1,2-ethanediyl);POLY(ETHYLENE GLYCOL) DIOLEATE, AVERAGE MN CA. 914;Poly(oxy-1,2-ethanediyl), .alpha.-(9Z)-1-oxo-9-octadecenyl-.omega.-(9Z)-1-oxo-9-octadecenyloxy-;PEG dioleate;Pegnol O 24;Pegosperse 400DO | | CAS: | 9005-07-6 | | MF: | C38H70O4 | | MW: | 590.96 | | EINECS: | | | Product Categories: | | | Mol File: | 9005-07-6.mol |  |
| | Polyoxyethylene dioleate ether Chemical Properties |
| Melting point | −15 °C(lit.) | | Boiling point | >260 °C(lit.) | | density | 0.945 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.471(lit.) | | Fp | 113 °C | | solubility | toluene, ethanol and acetone: soluble (dispersible in water) | | Odor | at 100.00?%. bland | | Water Solubility | toluene, ethanol and acetone: soluble (dispersible in water) | | Hydrophilic-Lipophilic Balance (HLB) | 7.5 | | Cosmetics Ingredients Functions | SURFACTANT - EMULSIFYING SURFACTANT - CLEANSING | | InChIKey | NKSOSPOXQKNIKJ-CLFAGFIQSA-N | | SMILES | C(OCCOC(=O)CCCCCCC/C=C\CCCCCCCC)(=O)CCCCCCC/C=C\CCCCCCCC | | EPA Substance Registry System | Polyethylene glycol dioleate (9005-07-6) |
| WGK Germany | 1 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | Polyoxyethylene dioleate ether Usage And Synthesis |
| Chemical Properties | Liquid | | Uses | Polyethylene Glycol 600 Dioleate is a surfactant suggested for use in paper defoamer formulations (emulsifier mineral oil or non mineral oil based), coatings (solvent and solventless systems emulsifier) and textile (spin finish lubricant) | | Uses | Plasticizer | | Definition | ChEBI: Polyoxyethylene dioleate is a fatty acid ester. |
| | Polyoxyethylene dioleate ether Preparation Products And Raw materials |
|