(1R)‐2,2‐difluorocyclopropane‐1‐carboxylic acid manufacturers
|
| | (1R)‐2,2‐difluorocyclopropane‐1‐carboxylic acid Basic information |
| Product Name: | (1R)‐2,2‐difluorocyclopropane‐1‐carboxylic acid | | Synonyms: | (1R)‐2,2‐difluorocyclopropane‐1‐carboxylic acid;Cyclopropanecarboxylic acid, 2,2-difluoro-, (1R)-;(1R)-2,2-difluorocyclopropanecarboxylic acid;(1R)-2,2-difluorocyclopropanecarboxylic acid - [D31145];(R)-2,2-difluorocyclopropanecarboxylic acid;(R)-2,2-difluorocyclopropane-1-carboxylic acid | | CAS: | 1631747-25-5 | | MF: | C4H4F2O2 | | MW: | 122.07 | | EINECS: | | | Product Categories: | | | Mol File: | 1631747-25-5.mol |  |
| | (1R)‐2,2‐difluorocyclopropane‐1‐carboxylic acid Chemical Properties |
| Boiling point | 188.7±40.0 °C(Predicted) | | density | 1.48±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.22±0.22(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C4H4F2O2/c5-4(6)1-2(4)3(7)8/h2H,1H2,(H,7,8)/t2-/m1/s1 | | InChIKey | KMLMOVWSQPHQME-UWTATZPHSA-N | | SMILES | [C@H]1(C(O)=O)CC1(F)F |
| | (1R)‐2,2‐difluorocyclopropane‐1‐carboxylic acid Usage And Synthesis |
| | (1R)‐2,2‐difluorocyclopropane‐1‐carboxylic acid Preparation Products And Raw materials |
|