trans-4-cyanocyclohexane-1-ylcarboxylic acid manufacturers
|
| | trans-4-cyanocyclohexane-1-ylcarboxylic acid Basic information |
| | trans-4-cyanocyclohexane-1-ylcarboxylic acid Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1/C8H11NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h6-7H,1-4H2,(H,10,11)/t6-,7- | | InChIKey | KJZWYCAIEUYAIW-LJGSYFOKNA-N | | SMILES | [C@@H]1(C(O)=O)CC[C@@H](C#N)CC1 |&1:0,6,r| |
| | trans-4-cyanocyclohexane-1-ylcarboxylic acid Usage And Synthesis |
| Uses |
Trans-4-cyanocyclohexanecarboxylic acid is a PROTAC linker that can be used in the synthesis of PROTACs.
|
| | trans-4-cyanocyclohexane-1-ylcarboxylic acid Preparation Products And Raw materials |
|