|
|
| | Azilsartan Impurity Basic information |
| Product Name: | Azilsartan Impurity | | Synonyms: | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 1-((2'-carbamoyl-[1,1'-biphenyl]-4-yl)methyl)-2-ethoxy-1H-benzo[d]imidazole-7-carboxylate;Azilsartan impurity 18/(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 1-((2'-carbamoyl-[1,1'-biphenyl]-4-yl)methyl)-2-ethoxy-1H-benzo[d]imidazole-7-carboxylate;Azilsartan-17;Azilsartan Impurity 32;1-[[2'-(Aminocarbonyl)[1,1'-biphenyl]-4-yl]methyl]-2-ethoxy-1H-benzimidazole-7-carboxylic Acid (5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl ester;1H-Benzimidazole-7-carboxylic acid, 1-[[2'-(aminocarbonyl)[1,1'-biphenyl]-4-yl]methyl]-2-ethoxy-, (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl ester;Azilsartan medoxomil impurity5;(5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl 3-[[4-(2-carbamoylphenyl)phenyl]methyl]-2-ethoxybenzimidazole | | CAS: | 1696392-12-7 | | MF: | C29H25N3O7 | | MW: | 527.52 | | EINECS: | | | Product Categories: | | | Mol File: | 1696392-12-7.mol |  |
| | Azilsartan Impurity Chemical Properties |
| Melting point | 172 - 176°C | | Boiling point | 749.2±70.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | -20°C, Inert atmosphere | | solubility | Acetone (Slightly), DMSO (Slightly) | | form | Solid | | pka | 15.84±0.50(Predicted) | | color | Off-White to Pale Yellow | | InChIKey | XLNGXZVKOASTLO-UHFFFAOYSA-N | | SMILES | C1(OCC)N(CC2=CC=C(C3=CC=CC=C3C(N)=O)C=C2)C2=C(C(OCC3=C(C)OC(=O)O3)=O)C=CC=C2N=1 |
| | Azilsartan Impurity Usage And Synthesis |
| Uses | Azilsartan Amide Medoxomil is an impurity from the synthesis of Azilsartan Medoxomil (A926910). Azilsartan medoxomil is a long-acting angiotensin II receptor blocker (ARB) that is used to lower hypertension. When Azilsartan medoxomil enters the gastrointestinal tract, it is rapidly converted to its active form, Azilsartan (A926900). |
| | Azilsartan Impurity Preparation Products And Raw materials |
|