|
|
| | Diquafosol Impurity 1 Basic information |
| Product Name: | Diquafosol Impurity 1 | | Synonyms: | Diquafosol Impurity 4(UP2U);Diquafosol Impurity 2;Diquafosol Impurity 3;Diuridine diphosphate;Uridine 5'-(trihydrogen diphosphate), P'→5'-ester with uridine;α-UTP;Up2U / UppU;Uridine 5'-(trihydrogen pyrophosphate), 5'→5'-ester with Uridine | | CAS: | 26184-65-6 | | MF: | C18H24N4O17P2 | | MW: | 630.35 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 26184-65-6.mol |  |
| | Diquafosol Impurity 1 Chemical Properties |
| density | 1.907±0.06 g/cm3(Predicted) | | pka | 0.83±0.50(Predicted) | | InChIKey | NYKBJLRPFUFPAX-BTTIJRIRNA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2[C@H]([C@@H](O)[C@H](N3C=CC(=O)NC3=O)O2)O)O[C@H]1N1C=CC(=O)NC1=O)O |&1:1,2,3,15,16,17,19,31,r| |
| | Diquafosol Impurity 1 Usage And Synthesis |
| Uses | P1,P2-Diuridine-5’-diphosphate (Up2U) is a symmetrical dinucleoside polyphosphate containing two pyrimidine base moieties. P1,P2-Diuridine-5’-diphosphate is also an activator of purinergic P2Y receptor[1]. | | References | [1] Hall, Ross H, et al. Nucleoside Polyphosphates. III. 1 Syntheses of Pyrimidine Nucleoside-2'(3'), 5'-diphosphates. Journal of the American Chemical Society 77.7 (1955): 1871-1875. |
| | Diquafosol Impurity 1 Preparation Products And Raw materials |
|