|
|
| | 2,5-BIS(4-AMINOPHENYL)-1,3,4-OXADIAZOLE Basic information |
| Product Name: | 2,5-BIS(4-AMINOPHENYL)-1,3,4-OXADIAZOLE | | Synonyms: | BAO;2,3-BIS(4-AMINOPHENYL)-1,3,4-OXADIAZOLE;2,5-BIS(4-AMINOPHENYL)-1,3,4-OXADIAZOLE;4,4'-(1,3,4-oxadiazole-2,5-diyl)dianiline;BAO, FOR FLUORESCENCE;4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline;1,3,4-Oxadiazole-2,5-diylbis(p-phenylene)diamine;4,4'-(1,3,4-Oxadiazole-5,2-diyl)bisaniline | | CAS: | 2425-95-8 | | MF: | C14H12N4O | | MW: | 252.27 | | EINECS: | 219-373-8 | | Product Categories: | Heterocycles;electronic | | Mol File: | 2425-95-8.mol |  |
| | 2,5-BIS(4-AMINOPHENYL)-1,3,4-OXADIAZOLE Chemical Properties |
| Melting point | 250-254 °C(lit.) | | Boiling point | 508.1±60.0 °C(Predicted) | | density | 1.301±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | pka | 2.53±0.10(Predicted) | | color | Light orange to Yellow to Green | | BRN | 243757 | | InChI | 1S/C14H12N4O/c15-11-5-1-9(2-6-11)13-17-18-14(19-13)10-3-7-12(16)8-4-10/h1-8H,15-16H2 | | InChIKey | MJZXFMSIHMJQBW-UHFFFAOYSA-N | | SMILES | Nc1ccc(cc1)-c2nnc(o2)-c3ccc(N)cc3 | | CAS DataBase Reference | 2425-95-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | F | 8-9-23 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,5-BIS(4-AMINOPHENYL)-1,3,4-OXADIAZOLE Usage And Synthesis |
| Uses | Aromatic polyimides were synthesized from 2, 5-bis(4-aminophenyl)-1,3,4-oxadiazole and 2,5-diamino-pyridine via high temperature polycondensation. BAO may be used to undertake Schiff-type staining of DNA obtained from cerebral cortex neurons. It may be used for cytofluorometric staining to estimate the nuclear DNA in living and preserved algae. | | General Description | 2, 5-Bis-(4-aminophenyl)-1, 3, 4-oxadiazole (BAO) is an oxadiazole-containing rigid bidentate ligands. | | Purification Methods | BAO is recrystallised from EtOH using charcoal and under N2 to avoid oxidation. It is a fluorescent stain for DNA [Yataghanas et al. Exptl Cell Res 56 59 1969]. [Beilstein 27 III/IV 8158.] |
| | 2,5-BIS(4-AMINOPHENYL)-1,3,4-OXADIAZOLE Preparation Products And Raw materials |
|