|
|
| | DTT-2,6-dicarboxylic acid Basic information |
| Product Name: | DTT-2,6-dicarboxylic acid | | Synonyms: | DTT-2,6-dicarboxylic acid;dithieno[3,2-b:2',3'-d]thiophene-2,6-dicarboxylic acid;thieno[3,2-b]thieno[2,2-d]thiophenedicarboxylicacid;DK7376 | | CAS: | 502764-53-6 | | MF: | C10H4O4S3 | | MW: | 284.33 | | EINECS: | | | Product Categories: | | | Mol File: | 502764-53-6.mol |  |
| | DTT-2,6-dicarboxylic acid Chemical Properties |
| Melting point | >300 °C(Solv: water (7732-18-5); ethyl ether (60-29-7); methanol (67-56-1)) | | Boiling point | 631.1±50.0 °C(Predicted) | | density | 1.880±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 2.90±0.30(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C10H4O4S3/c11-9(12)5-1-3-7(16-5)8-4(15-3)2-6(17-8)10(13)14/h1-2H,(H,11,12)(H,13,14) | | InChIKey | XQMFYBSHBCPMBJ-UHFFFAOYSA-N | | SMILES | C12C=C(C(O)=O)SC=1C1SC(C(O)=O)=CC=1S2 |
| | DTT-2,6-dicarboxylic acid Usage And Synthesis |
| | DTT-2,6-dicarboxylic acid Preparation Products And Raw materials |
|