| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2-(2-Boc-5-oxa-2-azaspiro[3.4]octan-7-yl)acetic acid
CAS:1330763-34-2
Purity:2-(2-Boc-5-oxa-2-azaspiro[3.4]octan-7-yl)acetic acid Package:100MG Remarks:795895-100MG
|
| Company Name: |
Birdo (Shanghai) Medical Technology Co., Ltd.
|
| Tel: |
021-58099077-8041 18601625411 |
| Email: |
sales@birdotech.com |
| Products Intro: |
Product Name:2-(2-(tert-butoxycarbonyl)-5-oxa-2-azaspiro[3.4]octan-7-yl)acetic acid
CAS:1330763-34-2
Purity:98% Package:5g;10g Remarks:AC541114
|
| Company Name: |
Taizhou Nanfeng Pharmaceutical Research Institute
|
| Tel: |
nanfengpharma@126.co 18616377689 |
| Email: |
nanfengpharma@126.com |
| Products Intro: |
Product Name:2-(2-Boc-5-oxa-2-azaspiro[3.4]octan-7-yl)acetic acid
CAS:1330763-34-2
Purity:98%+ Package:10g;100g;1kg;10kg;100kg
|
| Company Name: |
Shanghai Haohong Pharmaceutical Co., Ltd.
|
| Tel: |
400-8210725 4008210725 |
| Email: |
malulu@leyan.com |
| Products Intro: |
Product Name:2-(2-(tert-Butoxycarbonyl)-5-oxa-2-azaspiro[3.4]octan-7-yl)acetic acid
CAS:1330763-34-2
Purity:97%
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:2-(2-Boc-5-oxa-2-azaspiro[3.4]octan-7-yl)acetic acid
CAS:1330763-34-2
Purity:NULL Package:100mg Remarks:NULL
|
|
| | 2-(2-Boc-5-oxa-2-azaspiro[3.4]octan-7-yl)acetic acid Basic information |
| | 2-(2-Boc-5-oxa-2-azaspiro[3.4]octan-7-yl)acetic acid Chemical Properties |
| Boiling point | 425.8±30.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.55±0.10(Predicted) | | form | powder | | InChI | 1S/C13H21NO5/c1-12(2,3)19-11(17)14-7-13(8-14)5-9(6-18-13)4-10(15)16/h9H,4-8H2,1-3H3,(H,15,16) | | InChIKey | LTMIADFDXMGGRP-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(N1CC2(CC(CC(O)=O)CO2)C1)=O |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | 2-(2-Boc-5-oxa-2-azaspiro[3.4]octan-7-yl)acetic acid Usage And Synthesis |
| Uses | Spirocyclic building block was first synthesized by Carreira and coworkers, which provides a new area of chemical space with straightforward functional handles for further diversification. | | General Description | Spirocyclic building block was first synthesized by Carreira and coworkers, which provides a new area of chemical space with straightforward functional handles for further diversification. |
| | 2-(2-Boc-5-oxa-2-azaspiro[3.4]octan-7-yl)acetic acid Preparation Products And Raw materials |
|