| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | N-(3-(4-bromophenyl)-propanoyl)-L-homoserine lactone Basic information |
| Product Name: | N-(3-(4-bromophenyl)-propanoyl)-L-homoserine lactone | | Synonyms: | N-(3-(4-bromophenyl)-propanoyl)-L-homoserine lactone;N-(3-(4-bromophenyl)-propanoyl)-L-homoserine lactone >=95%;Benzenepropanamide, 4-bromo-N-[(3S)-tetrahydro-2-oxo-3-furanyl]-;N-(3-(4-bromophenyl)-propanoyl)-L-homoserine lactone | | CAS: | 959613-39-9 | | MF: | C13H14BrNO3 | | MW: | 312.16 | | EINECS: | | | Product Categories: | | | Mol File: | 959613-39-9.mol |  |
| | N-(3-(4-bromophenyl)-propanoyl)-L-homoserine lactone Chemical Properties |
| Boiling point | 571.9±50.0 °C(Predicted) | | density | 1.50±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 14.41±0.20(Predicted) | | form | solid | | InChI | 1S/C13H14BrNO3/c14-10-4-1-9(2-5-10)3-6-12(16)15-11-7-8-18-13(11)17/h1-2,4-5,11H,3,6-8H2,(H,15,16)/t11-/m0/s1 | | InChIKey | SGDZSJUYCLTPRG-NSHDSACASA-N | | SMILES | O=C(OCC1)[C@@]1([H])NC(CCC2=CC=C(Br)C=C2)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | N-(3-(4-bromophenyl)-propanoyl)-L-homoserine lactone Usage And Synthesis |
| Uses | AHL analog is a strong, broad-spectrum inhibitor of numerous LuxR-type receptors (e.g.: LuxR from Vibrio fischeri, LasR from P. aeruginosa, and TraR from Agrobacterium tumefaciens). This compound represents a good choice for initial testing of LuxR-type receptor inhibition. |
| | N-(3-(4-bromophenyl)-propanoyl)-L-homoserine lactone Preparation Products And Raw materials |
|