|
|
| | Dolutegravir Impurity 3 Basic information |
| Product Name: | Dolutegravir Impurity 3 | | Synonyms: | Dolutegravir impurity 2/2H-Pyrido[1,2-a]pyrazine-7-carboxamide, N-[(2,4-difluorophenyl)methyl]-1,8-dihydro-9-hydroxy-2-[(1R)-3-hydroxy-1-methylpropyl]-1,8-dioxo-;2H-Pyrido[1,2-a]pyrazine-7-carboxamide, N-[(2,4-difluorophenyl)methyl]-1,8-dihydro-9-hydroxy-2-[(1R)-3-hydroxy-1-methylpropyl]-1,8-dioxo-;Dolutegravir impurity A;Dolutegravir Impurity 3;N-[(2,4-Difluorophenyl)methyl]-1,8-dihydro-9-hydroxy-2-[(1R)-3-hydroxy-1-methylpropyl]-1,8-dioxo-2H-pyrido[1,2-a]pyrazine-7-carboxamide;Dolutegravir Impurity 51;(R)-N-(2,4-difluorobenzyl)-9-hydroxy-2-(4-hydroxybutan-2-yl)-1,8-dioxo-2,8-dihydro-1H-pyrido[1,2-a]p;DolutegravirImpurity9SodiumSalt | | CAS: | 1973402-05-9 | | MF: | C20H19F2N3O5 | | MW: | 419.38 | | EINECS: | | | Product Categories: | | | Mol File: | 1973402-05-9.mol |  |
| | Dolutegravir Impurity 3 Chemical Properties |
| Melting point | 95-100°C | | Boiling point | 662.3±55.0 °C(Predicted) | | density | 1.51±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.50±1.00(Predicted) | | color | Yellow | | InChIKey | NQVIDZANHVWALI-LLVKDONJSA-N | | SMILES | C12=C(O)C(=O)C(C(NCC3=CC=C(F)C=C3F)=O)=CN1C=CN([C@H](C)CCO)C2=O |
| | Dolutegravir Impurity 3 Usage And Synthesis |
| Uses | (R)-N-(2,4-Difluorobenzyl)-9-hydroxy-2-(4-hydroxybutan-2-yl)-1,8-dioxo-2,3,4,8-tetrahydro-1H-pyrido[1,2-a]pyrazine-7-carboxamide is impurity E of Dolutegravir (D528800), which is a second generation HIV-1 integrase strand transfer inhibitor. Dolutegravir is currently in Phase III clinical trials for the treatment of HIV infection. Dolutegravir has been shown to potently inhibit HIV replication in cells such as peripheral blood mononuclear cells (PBMCs), MT-4 cells and CIP4 cells infected with a self-inactivating PHIV lentiviral vector. |
| | Dolutegravir Impurity 3 Preparation Products And Raw materials |
|