Binap Pd G4 manufacturers
- Binap Pd G4
-
- $30.00 / 1KG
-
2020-11-16
- CAS:1599466-90-6
- Min. Order: 1KG
- Purity: 99
- Supply Ability: 100KG
|
| | Binap Pd G4 Basic information |
| Product Name: | Binap Pd G4 | | Synonyms: | Binap Pd G4;Methanesulfonato [(±)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthalene] (2'-methylamino-1,1'-biphenyl-2-yl)palladium(II);Methanesulfonato[(±)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthalene](2'-methylamino-1,1'-biphenyl-2-yl)palladium(II);(SP-4-3)-[[2′-(Diphenylphosphino)[1,1′-binaphthalen]-2-yl]diphenylphosphine-κP](methanesulfonato-κO)[2′-(methylamino-κN)[1,1′-biphenyl]-2-yl-κC]palladium;Methanesulfonato [(±)-2,2'-bis(diphenylphosphino)-1,1'-binaphthalene] (2'-methylamino-1,1'-biphenyl-2-YL)palladium(II)
(binap PD g4);rac-2,2’-bis(diphenylphosphino)-1,1’-binaphthyl Pd G4;rac-BINAP Pd G4 ChemBeads;rac-2,2’-bis(diphenylphosphino)-1,1’-binaphthyl Pd G4 | | CAS: | 1599466-90-6 | | MF: | C58H47NO3P2PdS | | MW: | 1006.45 | | EINECS: | | | Product Categories: | | | Mol File: | 1599466-90-6.mol |  |
| | Binap Pd G4 Chemical Properties |
| storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | solid | | Appearance | Light brown to brown Solid | | InChIKey | PNOKGRADISJRPD-UHFFFAOYSA-N | | SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC2C=CC=CC=2C=1C1C2C=CC=CC=2C=CC=1P(C1C=CC=CC=1)C1C=CC=CC=1)[Pd+2]1(N(C2=CC=CC=C2C2=CC=CC=[C-]12)C)[O-]S(=O)(=O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Binap Pd G4 Usage And Synthesis |
| Uses | A powerful ligand for classic cross-coupling reactions combined with the Buchwald Fourth Generation Palladacycle. Bench stable, soluble in most organic solvents. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst
reaction type: Cross Couplings |
| | Binap Pd G4 Preparation Products And Raw materials |
|