1,1,2-Triphenyl-2-(4- bromomethylphenyl)ethylene manufacturers
|
| | 1,1,2-Triphenyl-2-(4- bromomethylphenyl)ethylene Basic information |
| Product Name: | 1,1,2-Triphenyl-2-(4- bromomethylphenyl)ethylene | | Synonyms: | 1,1,2-Triphenyl-2-(4- bromomethylphenyl)ethylene;(2-(4-(bromomethyl)phenyl)ethene-1,1,2-triyl)tribenzene;Benzene, 1-(bromomethyl)-4-(1,2,2-triphenylethenyl)-;1-(Bromomethyl)-4-(1,2,2-triphenylethenyl)benzene;2-Triphenyl-2-(4- bromomethylphenyl)ethylene;1-(bromomethyl)-4-(1,2,2-triphenylvinyl)benzene;1-[(4-bromomethyl)phenyl]-1,2,2-triphenylethene | | CAS: | 1361969-01-8 | | MF: | C27H21Br | | MW: | 425.36 | | EINECS: | | | Product Categories: | | | Mol File: | 1361969-01-8.mol |  |
| | 1,1,2-Triphenyl-2-(4- bromomethylphenyl)ethylene Chemical Properties |
| Boiling point | 478.7±14.0 °C(Predicted) | | density | 1.269±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMF: soluble DMSO: soluble THF: soluble dichloromethane: soluble | | form | powder or crystals | | Appearance | White to off-white Solid | | InChI | InChI=1S/C27H21Br/c28-20-21-16-18-25(19-17-21)27(24-14-8-3-9-15-24)26(22-10-4-1-5-11-22)23-12-6-2-7-13-23/h1-19H,20H2 | | InChIKey | BCQFLZRLTIZMLQ-UHFFFAOYSA-N | | SMILES | C1(CBr)=CC=C(/C(/C2=CC=CC=C2)=C(\C2=CC=CC=C2)/C2=CC=CC=C2)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1,1,2-Triphenyl-2-(4- bromomethylphenyl)ethylene Usage And Synthesis |
| | 1,1,2-Triphenyl-2-(4- bromomethylphenyl)ethylene Preparation Products And Raw materials |
|