| Company Name: |
ChemeGen Gold
|
| Tel: |
18818260767 |
| Email: |
2625930290@qq.com |
| Products Intro: |
Product Name:XD14
CAS:1370888-71-3
Purity:98% Package:10 mg;50 mg;100 mg;500 mg;1 g;5 g;10 g
|
- XD14
-
- $59.00
-
2026-05-11
- CAS:1370888-71-3
- Purity: 98.40%
- Supply Ability: 10g
|
| Product Name: | XD14 | | Synonyms: | XD14;XD 14;XD-14;CS-2672;4-Acetyl-N-[5-[(diethylamino)sulfonyl]-2-hydroxyphenyl]-3-ethyl-5-methyl-1H-pyrrole-2-carboxamide;XD14,Inhibitor,Epigenetic Reader Domain,XD-14,XD 14,inhibit;1H-Pyrrole-2-carboxamide, 4-acetyl-N-[5-[(diethylamino)sulfonyl]-2-hydroxyphenyl]-3-ethyl-5-methyl-;4-acetyl-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-3-ethyl-5-methyl-1H-pyrrole-2-carboxamide;XD14, 10 mM in DMSO | | CAS: | 1370888-71-3 | | MF: | C20H27N3O5S | | MW: | 421.51 | | EINECS: | | | Product Categories: | | | Mol File: | 1370888-71-3.mol |  |
| density | 1.300±0.06 g/cm3(Predicted) | | form | Solid | | pka | 7.47±0.50(Predicted) | | color | Off-white to light yellow | | InChI | InChI=1S/C20H27N3O5S/c1-6-15-18(13(5)24)12(4)21-19(15)20(26)22-16-11-14(9-10-17(16)25)29(27,28)23(7-2)8-3/h9-11,21,25H,6-8H2,1-5H3,(H,22,26) | | InChIKey | DPBKLIVPNYGQQG-UHFFFAOYSA-N | | SMILES | N1C(C)=C(C(C)=O)C(CC)=C1C(NC1=CC(S(N(CC)CC)(=O)=O)=CC=C1O)=O |
| Uses | 4-Acetyl-N-[5-[(diethylamino)sulfonyl]-2-hydroxyphenyl]-3-ethyl-5-methyl-1H-pyrrole-2-carboxamide is a bromodomain and extra-terminal (BET) inhibitor and exerts a strong inhibitory potential on the proliferation of specific leukemia cell lines. | | IC 50 | BRD2: 170 nM (Kd); BRD3: 380 nM (Kd); BRD4: 160 nM (Kd) |
| | XD14 Preparation Products And Raw materials |
|