|
|
| | 1-(3,5-dimethylphenyl)-6-(1-methylethyl)isoquinoline Basic information | | Physical Form |
| | 1-(3,5-dimethylphenyl)-6-(1-methylethyl)isoquinoline Chemical Properties |
| Boiling point | 394.6±11.0 °C(Predicted) | | density | 1.040±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 5.17±0.38(Predicted) | | Appearance | Colorless to light yellow Viscous Liquid | | InChI | InChI=1S/C20H21N/c1-13(2)16-5-6-19-17(12-16)7-8-21-20(19)18-10-14(3)9-15(4)11-18/h5-13H,1-4H3 | | InChIKey | XYUORYRNDCCNPG-UHFFFAOYSA-N | | SMILES | C1(C2=CC(C)=CC(C)=C2)C2=C(C=C(C(C)C)C=C2)C=CN=1 |
| | 1-(3,5-dimethylphenyl)-6-(1-methylethyl)isoquinoline Usage And Synthesis |
| Physical Form | Solid | | Uses | 1-(3,5-dimethylphenyl)-6-(1-methylethyl)isoquinoline is a useful research chemical. |
| | 1-(3,5-dimethylphenyl)-6-(1-methylethyl)isoquinoline Preparation Products And Raw materials |
|