2-Diphenylphosphino-2',6'-bis(dimethylamino)-1,1'-biphenyl manufacturers
|
| | 2-Diphenylphosphino-2',6'-bis(dimethylamino)-1,1'-biphenyl Basic information | | Reactions |
| Product Name: | 2-Diphenylphosphino-2',6'-bis(dimethylamino)-1,1'-biphenyl | | Synonyms: | 2-Diphenylphosphino-2',6'-bis(dimethylamino)-1,1'-biphenyl, min. 98%;2-DIPHENYLPHOSPHINO-2',6'-BIS(DIMETHYLAMINO)-1,1'-BIPHENYL,MIN.98%PHCPHOS;2-Diphenylphosphino-2',6'-bis(dimethylamino)-1,1'-biphenyl,PhCPhos;2-Diphenylphosphino-2',6'-bis(dimethylamino)-1,1'-biphenyl;amino)-1,1'-biphenyL;phosphino-2',6'-bis(dimethyL;[1,1'-Biphenyl]-2,6-diamine, 2'-(diphenylphosphino)-N2,N2,N6,N6-tetramethyl-;2'-(diphenylphosphino)-6-methoxy-N,N-dimethylbiphenyl-2-amine | | CAS: | 1447963-71-4 | | MF: | C28H29N2P | | MW: | 424.52 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine;Buchwald Ligands Series;Buchwald Ligands&Precatalysts | | Mol File: | 1447963-71-4.mol |  |
| | 2-Diphenylphosphino-2',6'-bis(dimethylamino)-1,1'-biphenyl Chemical Properties |
| Boiling point | 569.7±50.0 °C(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | pka | 4.96±0.28(Predicted) | | form | solid | | color | tan | | InChI | 1S/C28H29N2P/c1-29(2)25-19-13-20-26(30(3)4)28(25)24-18-11-12-21-27(24)31(22-14-7-5-8-15-22)23-16-9-6-10-17-23/h5-21H,1-4H3 | | InChIKey | BGAVYUHVZHVUKO-UHFFFAOYSA-N | | SMILES | P(c3c(cccc3)c4c(cccc4N(C)C)N(C)C)(c2ccccc2)c1ccccc1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Diphenylphosphino-2',6'-bis(dimethylamino)-1,1'-biphenyl Usage And Synthesis |
| Reactions | Ligand for the Palladium catalyzed chlorosulfonylation of aryl boronic acids
Ligand for the Palladium-catalyzed Buchwald-Hartwig cross-coupling of hindered primary amines and aryl halides.
|
| | 2-Diphenylphosphino-2',6'-bis(dimethylamino)-1,1'-biphenyl Preparation Products And Raw materials |
|