|
|
| | 5-Quinolinecarbonitrile, 8-hydroxy- Basic information |
| | 5-Quinolinecarbonitrile, 8-hydroxy- Chemical Properties |
| Melting point | 174 °C | | Boiling point | 415.9±30.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | pka | 2.93±0.10(Predicted) | | form | solid | | InChI | 1S/C10H6N2O/c11-6-7-3-4-9(13)10-8(7)2-1-5-12-10/h1-5,13H | | InChIKey | UIYLRFFZJAAGMT-UHFFFAOYSA-N | | SMILES | OC1=CC=C(C#N)C2=CC=CN=C21 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 5-Quinolinecarbonitrile, 8-hydroxy- Usage And Synthesis |
| | 5-Quinolinecarbonitrile, 8-hydroxy- Preparation Products And Raw materials |
|