| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Propanoic acid, 2-(4-bromophenoxy)-2-methyl-, ethyl ester Basic information |
| | Propanoic acid, 2-(4-bromophenoxy)-2-methyl-, ethyl ester Chemical Properties |
| Boiling point | 106-108 °C(Press: 0.02 Torr) | | density | 1.331±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C12H15BrO3/c1-4-15-11(14)12(2,3)16-10-7-5-9(13)6-8-10/h5-8H,4H2,1-3H3 | | InChIKey | IOVDAUBZQSIHIQ-UHFFFAOYSA-N | | SMILES | CCOC(C(C)(OC1=CC=C(Br)C=C1)C)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 |
| | Propanoic acid, 2-(4-bromophenoxy)-2-methyl-, ethyl ester Usage And Synthesis |
| | Propanoic acid, 2-(4-bromophenoxy)-2-methyl-, ethyl ester Preparation Products And Raw materials |
|